[dimethyl-[trichlorostannyl(trimethylsilyl)amino]silyl]methane structure
|
Common Name | [dimethyl-[trichlorostannyl(trimethylsilyl)amino]silyl]methane | ||
|---|---|---|---|---|
| CAS Number | 62470-61-5 | Molecular Weight | 385.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H18Cl3NSi2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [dimethyl-[trichlorostannyl(trimethylsilyl)amino]silyl]methane |
|---|
| Molecular Formula | C6H18Cl3NSi2Sn |
|---|---|
| Molecular Weight | 385.44500 |
| Exact Mass | 384.90700 |
| InChIKey | IIVCHIXLMCUMIN-UHFFFAOYSA-K |
| SMILES | C[Si](C)(C)N([Si](C)(C)C)[Sn](Cl)(Cl)Cl |
|
~83%
[dimethyl-[tric... CAS#:62470-61-5 |
| Literature: Wrackmeyer, Bernd; Pedall, Andreas; Weidinger, Juergen Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2001 , vol. 56, # 10 p. 1009 - 1014 |
|
~%
[dimethyl-[tric... CAS#:62470-61-5 |
| Literature: Wrackmeyer, Bernd; Pedall, Andreas; Weidinger, Juergen Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2001 , vol. 56, # 10 p. 1009 - 1014 |
|
~%
[dimethyl-[tric... CAS#:62470-61-5 |
| Literature: Wrackmeyer, Bernd; Pedall, Andreas; Weidinger, Juergen Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2001 , vol. 56, # 10 p. 1009 - 1014 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |