1,3-Di(4-hydroxymethylphenyl)benzene structure
|
Common Name | 1,3-Di(4-hydroxymethylphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 6249-92-9 | Molecular Weight | 290.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[3-[4-(hydroxymethyl)phenyl]phenyl]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18O2 |
|---|---|
| Molecular Weight | 290.35600 |
| Exact Mass | 290.13100 |
| PSA | 40.46000 |
| LogP | 4.00520 |
| InChIKey | WUDFKQWGZUEYDF-UHFFFAOYSA-N |
| SMILES | OCc1ccc(-c2cccc(-c3ccc(CO)cc3)c2)cc1 |
|
~%
1,3-Di(4-hydrox... CAS#:6249-92-9 |
| Literature: Campbell,T.W. Journal of the American Chemical Society, 1960 , vol. 82, p. 3126 - 3128 |
|
~%
1,3-Di(4-hydrox... CAS#:6249-92-9 |
| Literature: Campbell,T.W. Journal of the American Chemical Society, 1960 , vol. 82, p. 3126 - 3128 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| [1,1':3',1''-Terphenyl]-4,4''-dimethanol(9CI) |
| 4,4''-Di-hydroxymethyl-terphenyl |
| 1,3-DI(4-HYDROXYMETHYLPHENYL)BENZENE |