ethyl 4,4-dimethoxy-2-phenylsulfanylbutanoate structure
|
Common Name | ethyl 4,4-dimethoxy-2-phenylsulfanylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 62495-34-5 | Molecular Weight | 284.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4,4-dimethoxy-2-phenylsulfanylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O4S |
|---|---|
| Molecular Weight | 284.37100 |
| Exact Mass | 284.10800 |
| PSA | 70.06000 |
| LogP | 2.71940 |
| InChIKey | GWDWYTHGXMSWES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(OC)OC)Sc1ccccc1 |
|
~%
ethyl 4,4-dimet... CAS#:62495-34-5 |
| Literature: Inomata,K. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, # 3 p. 930 - 932 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethyl-4,4-dimethoxy-2-phenylthiobutyrat |