4-(3-methylphenoxy)benzoic acid structure
|
Common Name | 4-(3-methylphenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 62507-85-1 | Molecular Weight | 228.24300 | |
| Density | 1.208g/cm3 | Boiling Point | 375.6ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143ºC | |
| Name | 4-(3-methylphenoxy)benzoic acid |
|---|
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 375.6ºC at 760 mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 143ºC |
| Exact Mass | 228.07900 |
| PSA | 46.53000 |
| LogP | 3.48550 |
| Index of Refraction | 1.598 |
| InChIKey | XBZMSARMROSBTE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Oc2ccc(C(=O)O)cc2)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |