2-nitro-4-nonylphenol
2-nitro-4-nonylphenol structure
|
Common Name | 2-nitro-4-nonylphenol | ||
|---|---|---|---|---|
| CAS Number | 62529-25-3 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nitro-4-nonylphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 66.05000 |
| LogP | 5.11670 |
| InChIKey | YOXDEECVKSRMRN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1ccc(O)c([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
2-nitro-4-nonyl... CAS#:62529-25-3 |
| Literature: Mitsubishi Paper Mills Limited; Mitsubishi Kasei Corporation Patent: US5106989 A1, 1992 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:79494-14-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Nitro-4-nonyl-phenol |
| Phenol,2-nitro-4-nonyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-nitro-4-nonylphenol have? |
| A: English synonyms of 2-nitro-4-nonylphenol: 2-Nitro-4-nonyl-phenol, Phenol,2-nitro-4-nonyl. |
| Q: What is the InChIKey of 2-nitro-4-nonylphenol? |
| A: InChIKey of 2-nitro-4-nonylphenol is YOXDEECVKSRMRN-UHFFFAOYSA-N. |
| Q: What is the English name of 2-nitro-4-nonylphenol? |
| A: The English name of 2-nitro-4-nonylphenol is 2-nitro-4-nonylphenol. |
| Q: What is the SMILES notation of 2-nitro-4-nonylphenol? |
| A: SMILES notation of 2-nitro-4-nonylphenol is CCCCCCCCCc1ccc(O)c([N+](=O)[O-])c1. |
| Q: What is the polar surface area (PSA) of 2-nitro-4-nonylphenol? |
| A: Polar surface area (PSA) of 2-nitro-4-nonylphenol is 66.05000. |
| Q: What is the LogP of 2-nitro-4-nonylphenol? |
| A: LogP of 2-nitro-4-nonylphenol is 5.11670. |
| Q: What are the downstream products of 2-nitro-4-nonylphenol? |
| A: Related downstream products(CAS) of 2-nitro-4-nonylphenol: 79494-14-7. |
| Q: What is the molecular weight of 2-nitro-4-nonylphenol? |
| A: Molecular weight of 2-nitro-4-nonylphenol is 265.34800. |
| Q: What is the CAS number of 2-nitro-4-nonylphenol? |
| A: CAS number of 2-nitro-4-nonylphenol is 62529-25-3. |
| Q: What is the Chinese name of 62529-25-3? |
| A: Chinese name of 62529-25-3 is 62529-25-3. |