2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid
2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid structure
|
Common Name | 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 62529-64-0 | Molecular Weight | 262.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14O6S |
|---|---|
| Molecular Weight | 262.28000 |
| Exact Mass | 262.05100 |
| PSA | 101.44000 |
| LogP | 1.53490 |
| InChIKey | QAUIQQSIYDXLLJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.OCCc1ccc2c(c1)OCO2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
2-(1,3-benzodio... CAS#:62529-64-0 |
| Literature: Romeiro, Luiz A.S.; Da Silva Ferreira, Marcos; Da Silva, Leandro L.; Castro, Helena C.; Miranda, Ana L.P.; Silva, Claudia L.M.; Noel, Franois; Nascimento, Jessica B.; Araujo, Claudia V.; Tibirica, Eduardo; Barreiro, Eliezer J.; Fraga, Carlos A.M. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 7 p. 3000 - 3012 |
|
~94%
2-(1,3-benzodio... CAS#:62529-64-0 |
| Literature: McNeilab, Inc. Patent: EP256888 B1, 1991 ; |
|
~%
2-(1,3-benzodio... CAS#:62529-64-0 |
| Literature: Romeiro, Luiz A.S.; Da Silva Ferreira, Marcos; Da Silva, Leandro L.; Castro, Helena C.; Miranda, Ana L.P.; Silva, Claudia L.M.; Noel, Franois; Nascimento, Jessica B.; Araujo, Claudia V.; Tibirica, Eduardo; Barreiro, Eliezer J.; Fraga, Carlos A.M. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 7 p. 3000 - 3012 |
![2-(BENZO[D][1,3]DIOXOL-5-YL)ETHANOL structure](https://image.chemsrc.com/caspic/084/6006-82-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4-methylenedioxyphenethyl mesylate |
| 1,3-Benzodioxole-5-ethanol,methanesulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: The English name of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid. |
| Q: What is the Chinese name of 62529-64-0? |
| A: Chinese name of 62529-64-0 is 62529-64-0. |
| Q: What is the molecular formula of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: Molecular formula of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is C10H14O6S. |
| Q: What is the SMILES notation of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: SMILES notation of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is CS(=O)(=O)O.OCCc1ccc2c(c1)OCO2. |
| Q: What are the upstream materials of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: Related upstream materials(CAS) of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid: 6006-82-2;124-63-0;94-59-7. |
| Q: What is the molecular weight of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: Molecular weight of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is 262.28000. |
| Q: What is the LogP of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: LogP of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is 1.53490. |
| Q: What English synonyms does 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid have? |
| A: English synonyms of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid: 3,4-methylenedioxyphenethyl mesylate, 1,3-Benzodioxole-5-ethanol,methanesulfonate. |
| Q: What is the InChIKey of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: InChIKey of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is QAUIQQSIYDXLLJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid? |
| A: CAS number of 2-(1,3-benzodioxol-5-yl)ethanol,methanesulfonic acid is 62529-64-0. |