3,6-Dichloro-2-methoxybenzoic acid mixt. with 2-(4-chloro-2-methylphenoxy)propanoic acid and (2,4-dichlorophenoxy)acetic acid structure
|
Common Name | 3,6-Dichloro-2-methoxybenzoic acid mixt. with 2-(4-chloro-2-methylphenoxy)propanoic acid and (2,4-dichlorophenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 62532-18-7 | Molecular Weight | 656.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23Cl5O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-Dichloro-2-methoxybenzoic acid mixt. with 2-(4-chloro-2-methylphenoxy)propanoic acid and (2,4-dichlorophenoxy)acetic acid |
|---|
| Molecular Formula | C26H23Cl5O9 |
|---|---|
| Molecular Weight | 656.7 |
| InChIKey | DITVGQSHKRMAFG-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.Cc1cc(Cl)ccc1OC(C)C(=O)O.O=C(O)COc1ccc(Cl)cc1Cl |