Pholcodine monohydrate
Modify Date: 2026-07-02 07:07:30
Pholcodine monohydrate structure
|
Common Name | Pholcodine monohydrate | ||
|---|---|---|---|---|
| CAS Number | 6254-99-5 | Molecular Weight | 416.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pholcodine monohydrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H32N2O5 |
|---|---|
| Molecular Weight | 416.5 |
| InChIKey | VOMHFFCEDKOLBR-RNFKYSJUSA-N |
| SMILES | CN1CCC23c4c5ccc(OCCN6CCOCC6)c4OC2C(O)C=CC3C1C5.O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Pholcodine monohydrate? |
| A: Molecular weight of Pholcodine monohydrate is 416.5. |
| Q: What is the CAS number of Pholcodine monohydrate? |
| A: CAS number of Pholcodine monohydrate is 6254-99-5. |
| Q: What is the Chinese name of 6254-99-5? |
| A: Chinese name of 6254-99-5 is 6254-99-5. |
| Q: What is the SMILES notation of Pholcodine monohydrate? |
| A: SMILES notation of Pholcodine monohydrate is CN1CCC23c4c5ccc(OCCN6CCOCC6)c4OC2C(O)C=CC3C1C5.O. |
| Q: What is the English name of Pholcodine monohydrate? |
| A: The English name of Pholcodine monohydrate is Pholcodine monohydrate. |
| Q: What is the molecular formula of Pholcodine monohydrate? |
| A: Molecular formula of Pholcodine monohydrate is C23H32N2O5. |
| Q: What is the InChIKey of Pholcodine monohydrate? |
| A: InChIKey of Pholcodine monohydrate is VOMHFFCEDKOLBR-RNFKYSJUSA-N. |