2,3-dibromo-2-nitropentane
2,3-dibromo-2-nitropentane structure
|
Common Name | 2,3-dibromo-2-nitropentane | ||
|---|---|---|---|---|
| CAS Number | 62544-98-3 | Molecular Weight | 274.93800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dibromo-2-nitropentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H9Br2NO2 |
|---|---|
| Molecular Weight | 274.93800 |
| Exact Mass | 272.90000 |
| PSA | 45.82000 |
| LogP | 3.07090 |
| InChIKey | ZSJVQFKYVUFIBN-UHFFFAOYSA-N |
| SMILES | CCC(Br)C(C)(Br)[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3-dibromo-2-n... CAS#:62544-98-3 |
| Literature: Kochany,J.; Piotrowska,H. Bulletin de l'Academie Polonaise des Sciences, Serie des Sciences Chimiques, 1976 , vol. 24, p. 705 - 718 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentane,2,3-dibromo-2-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,3-dibromo-2-nitropentane? |
| A: SMILES notation of 2,3-dibromo-2-nitropentane is CCC(Br)C(C)(Br)[N+](=O)[O-]. |
| Q: What is the LogP of 2,3-dibromo-2-nitropentane? |
| A: LogP of 2,3-dibromo-2-nitropentane is 3.07090. |
| Q: What is the molecular formula of 2,3-dibromo-2-nitropentane? |
| A: Molecular formula of 2,3-dibromo-2-nitropentane is C5H9Br2NO2. |
| Q: What is the English name of 2,3-dibromo-2-nitropentane? |
| A: The English name of 2,3-dibromo-2-nitropentane is 2,3-dibromo-2-nitropentane. |
| Q: What is the Chinese name of 62544-98-3? |
| A: Chinese name of 62544-98-3 is 62544-98-3. |
| Q: What is the molecular weight of 2,3-dibromo-2-nitropentane? |
| A: Molecular weight of 2,3-dibromo-2-nitropentane is 274.93800. |
| Q: What English synonyms does 2,3-dibromo-2-nitropentane have? |
| A: English synonyms of 2,3-dibromo-2-nitropentane: Pentane,2,3-dibromo-2-nitro. |
| Q: What is the InChIKey of 2,3-dibromo-2-nitropentane? |
| A: InChIKey of 2,3-dibromo-2-nitropentane is ZSJVQFKYVUFIBN-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2,3-dibromo-2-nitropentane? |
| A: Related upstream materials(CAS) of 2,3-dibromo-2-nitropentane: 6065-19-6. |
| Q: What is the polar surface area (PSA) of 2,3-dibromo-2-nitropentane? |
| A: Polar surface area (PSA) of 2,3-dibromo-2-nitropentane is 45.82000. |