1,2-dibromo-3-methyl-1-nitrobutane
1,2-dibromo-3-methyl-1-nitrobutane structure
|
Common Name | 1,2-dibromo-3-methyl-1-nitrobutane | ||
|---|---|---|---|---|
| CAS Number | 62545-00-0 | Molecular Weight | 274.93800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-dibromo-3-methyl-1-nitrobutane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H9Br2NO2 |
|---|---|
| Molecular Weight | 274.93800 |
| Exact Mass | 272.90000 |
| PSA | 45.82000 |
| LogP | 2.92680 |
| InChIKey | HZLKBGUYHVCGQU-UHFFFAOYSA-N |
| SMILES | CC(C)C(Br)C(Br)[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,2-dibromo-3-m... CAS#:62545-00-0 |
| Literature: Kochany,J.; Piotrowska,H. Bulletin de l'Academie Polonaise des Sciences, Serie des Sciences Chimiques, 1976 , vol. 24, p. 705 - 718 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Butane,1,2-dibromo-3-methyl-1-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: InChIKey of 1,2-dibromo-3-methyl-1-nitrobutane is HZLKBGUYHVCGQU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: CAS number of 1,2-dibromo-3-methyl-1-nitrobutane is 62545-00-0. |
| Q: What is the SMILES notation of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: SMILES notation of 1,2-dibromo-3-methyl-1-nitrobutane is CC(C)C(Br)C(Br)[N+](=O)[O-]. |
| Q: What is the molecular weight of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: Molecular weight of 1,2-dibromo-3-methyl-1-nitrobutane is 274.93800. |
| Q: What is the English name of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: The English name of 1,2-dibromo-3-methyl-1-nitrobutane is 1,2-dibromo-3-methyl-1-nitrobutane. |
| Q: What is the molecular formula of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: Molecular formula of 1,2-dibromo-3-methyl-1-nitrobutane is C5H9Br2NO2. |
| Q: What English synonyms does 1,2-dibromo-3-methyl-1-nitrobutane have? |
| A: English synonyms of 1,2-dibromo-3-methyl-1-nitrobutane: Butane,1,2-dibromo-3-methyl-1-nitro. |
| Q: What are the upstream materials of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: Related upstream materials(CAS) of 1,2-dibromo-3-methyl-1-nitrobutane: 33972-66-6. |
| Q: What is the polar surface area (PSA) of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: Polar surface area (PSA) of 1,2-dibromo-3-methyl-1-nitrobutane is 45.82000. |
| Q: What is the LogP of 1,2-dibromo-3-methyl-1-nitrobutane? |
| A: LogP of 1,2-dibromo-3-methyl-1-nitrobutane is 2.92680. |