dimethyl (2E)-4-formyl-9-oxa-4-azabicyclo[6.1.0]non-2-ene-1,2-dicarboxylate structure
|
Common Name | dimethyl (2E)-4-formyl-9-oxa-4-azabicyclo[6.1.0]non-2-ene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 62563-04-6 | Molecular Weight | 269.25100 | |
| Density | 1.412g/cm3 | Boiling Point | 406.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | dimethyl (6E)-5-formyl-9-oxa-5-azabicyclo[6.1.0]non-6-ene-7,8-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 406.7ºC at 760 mmHg |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25100 |
| Flash Point | 199.8ºC |
| Exact Mass | 269.09000 |
| PSA | 85.44000 |
| LogP | 0.17990 |
| Index of Refraction | 1.58 |
| InChIKey | MDBYQYXBWZDEAL-VURMDHGXSA-N |
| SMILES | COC(=O)C1=CN(C=O)CCCC2OC12C(=O)OC |
|
~%
dimethyl (2E)-4... CAS#:62563-04-6 |
| Literature: Mariano,P.S. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 2903 - 2910 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2E)-1-formyl-4,5t-epoxy-1,4,5,6,7,8-hexahydro-azocine-3,4r-dicarboxylic acid dimethyl ester |
| 1-formyl-3,4-dicarbomethoxy-4,5-epoxy-hexahydro-azocine |