1,2,4,5-Tetrafluoro-3-nitrobenzene structure
|
Common Name | 1,2,4,5-Tetrafluoro-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 6257-03-0 | Molecular Weight | 195.071 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 223.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C6HF4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.0±25.9 °C | |
| Name | 1,2,4,5-Tetrafluoro-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 223.6±35.0 °C at 760 mmHg |
| Molecular Formula | C6HF4NO2 |
| Molecular Weight | 195.071 |
| Flash Point | 89.0±25.9 °C |
| Exact Mass | 194.994339 |
| PSA | 45.82000 |
| LogP | 1.37 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | YLNJZWIHZRLYRI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(F)c(F)cc(F)c1F |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1,2,4,5-tetrafluoro-3-nitro- |
| MFCD02093333 |
| 1,2,4,5-Tetrafluoro-3-nitrobenzene |