3-(2-Methyl-5-Nitroimidazole-1-Yl)-1,2-Propanediol structure
|
Common Name | 3-(2-Methyl-5-Nitroimidazole-1-Yl)-1,2-Propanediol | ||
|---|---|---|---|---|
| CAS Number | 62580-80-7 | Molecular Weight | 201.18000 | |
| Density | 1.53g/cm3 | Boiling Point | 512.8ºC at 760 mmHg | |
| Molecular Formula | C7H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
Use of 3-(2-Methyl-5-Nitroimidazole-1-Yl)-1,2-PropanediolOrnidazole diol (Ro 11-2616) is a diol produced by ornidazole rapidly hydrolysing in basic solutions[1]. |
| Name | 3-(2-methyl-5-nitroimidazol-1-yl)propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Ornidazole diol (Ro 11-2616) is a diol produced by ornidazole rapidly hydrolysing in basic solutions[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 512.8ºC at 760 mmHg |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18000 |
| Flash Point | 263.9ºC |
| Exact Mass | 201.07500 |
| PSA | 104.10000 |
| Index of Refraction | 1.625 |
| InChIKey | QQNYOVQUGLPEFB-UHFFFAOYSA-N |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CO |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ro 11-2616 |
| DA 3838 |
| 3-(2-Methyl-5-Nitroimidazole-1-Yl)-1,2-Propanediol |
| Ornidazole Impurity 2 |