4-(Chloromethyl)-2-(4-fluorophenyl)-5-methyloxazole structure
|
Common Name | 4-(Chloromethyl)-2-(4-fluorophenyl)-5-methyloxazole | ||
|---|---|---|---|---|
| CAS Number | 625826-69-9 | Molecular Weight | 225.647 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 334.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.2±30.7 °C | |
| Name | 4-(Chloromethyl)-2-(4-fluorophenyl)-5-methyloxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.6±52.0 °C at 760 mmHg |
| Molecular Formula | C11H9ClFNO |
| Molecular Weight | 225.647 |
| Flash Point | 156.2±30.7 °C |
| Exact Mass | 225.035675 |
| PSA | 26.03000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | AHJILHLRJFFFGV-UHFFFAOYSA-N |
| SMILES | Cc1oc(-c2ccc(F)cc2)nc1CCl |
|
~42%
4-(Chloromethyl... CAS#:625826-69-9 |
| Literature: Shibata, Yoshihiro; Kagechika, Katsuji; Yamaguchi, Mitsuhiro; Yoshikawa, Kenji; Chiba, Kiyoshi; Takano, Hiromichi; Akiyama, Chiyuki; Ono, Mayumi; Nishi, Mina; Kubo, Hideo; Kobayashi, Yoshimasa; Usui, Hiroyuki Chemical and Pharmaceutical Bulletin, 2013 , vol. 61, # 12 p. 1248 - 1263 |
|
~%
4-(Chloromethyl... CAS#:625826-69-9 |
| Literature: Kuhn, Bernd; Hilpert, Hans; Benz, Joerg; Binggeli, Alfred; Grether, Uwe; Humm, Roland; Maerki, Hans Peter; Meyer, Markus; Mohr, Peter Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 15 p. 4016 - 4020 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Oxazole, 4-(chloromethyl)-2-(4-fluorophenyl)-5-methyl- |
| 4-(Chloromethyl)-2-(4-fluorophenyl)-5-methyl-1,3-oxazole |