2-chloro-3-(2-chloroethyl)-4-methylquinoline structure
|
Common Name | 2-chloro-3-(2-chloroethyl)-4-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 62595-01-1 | Molecular Weight | 240.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3-(2-chloroethyl)-4-methylquinoline |
|---|
| Molecular Formula | C12H11Cl2N |
|---|---|
| Molecular Weight | 240.12800 |
| Exact Mass | 239.02700 |
| PSA | 12.89000 |
| LogP | 3.97790 |
| InChIKey | MFGPBXGCPSQYJE-UHFFFAOYSA-N |
| SMILES | Cc1c(CCCl)c(Cl)nc2ccccc12 |
|
~%
2-chloro-3-(2-c... CAS#:62595-01-1 |
| Literature: Raman Proceedings - Indian Academy of Sciences, Section A, 1958 , # 47 p. 244,248 |
|
~%
2-chloro-3-(2-c... CAS#:62595-01-1 |
| Literature: Raman Proceedings - Indian Academy of Sciences, Section A, 1958 , # 47 p. 244,248 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |