3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione
3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 62595-33-9 | Molecular Weight | 254.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N4S |
|---|---|
| Molecular Weight | 254.31000 |
| Exact Mass | 254.06300 |
| PSA | 82.40000 |
| LogP | 2.61800 |
| InChIKey | GNMZCHUOHATABP-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(-c2ccccc2)n1-c1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~23%
3-phenyl-4-pyri... CAS#:62595-33-9 |
| Literature: Malbec, Frederique; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1689 - 1698 |
|
~%
3-phenyl-4-pyri... CAS#:62595-33-9 |
| Literature: Malbec, Frederique; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1689 - 1698 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: SMILES notation of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is S=c1[nH]nc(-c2ccccc2)n1-c1ccccn1. |
| Q: What is the InChIKey of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: InChIKey of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is GNMZCHUOHATABP-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: Related upstream materials(CAS) of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione: 504-29-0;5333-86-8. |
| Q: What is the English name of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: The English name of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione. |
| Q: What is the molecular formula of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: Molecular formula of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is C13H10N4S. |
| Q: What is the CAS number of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: CAS number of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is 62595-33-9. |
| Q: What is the LogP of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: LogP of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is 2.61800. |
| Q: What is the Chinese name of 62595-33-9? |
| A: Chinese name of 62595-33-9 is 62595-33-9. |
| Q: What is the molecular weight of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: Molecular weight of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is 254.31000. |
| Q: What is the polar surface area (PSA) of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione? |
| A: Polar surface area (PSA) of 3-phenyl-4-pyridin-2-yl-1H-1,2,4-triazole-5-thione is 82.40000. |