Benzene,1,2,3,4,5-pentachloro-6-[(chloromethyl)thio]- structure
|
Common Name | Benzene,1,2,3,4,5-pentachloro-6-[(chloromethyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 62601-17-6 | Molecular Weight | 330.87400 | |
| Density | 1.76g/cm3 | Boiling Point | 339.8ºC at 760 mmHg | |
| Molecular Formula | C7H2Cl6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.6ºC | |
| Name | 1,2,3,4,5-pentachloro-6-(chloromethylsulfanyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 339.8ºC at 760 mmHg |
| Molecular Formula | C7H2Cl6S |
| Molecular Weight | 330.87400 |
| Flash Point | 150.6ºC |
| Exact Mass | 327.80100 |
| PSA | 25.30000 |
| LogP | 6.24200 |
| Index of Refraction | 1.648 |
| InChIKey | SEBXHYNSUTYHGW-UHFFFAOYSA-N |
| SMILES | ClCSc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
Benzene,1,2,3,4... CAS#:62601-17-6 |
| Literature: Goralski,C.T.; Burk,G.A. Journal of Organic Chemistry, 1977 , vol. 42, p. 3094 - 3096 |
|
~%
Benzene,1,2,3,4... CAS#:62601-17-6 |
| Literature: Senning,A.; Lawesson,S.-O. Acta Chemica Scandinavica (1947-1973), 1962 , vol. 16, p. 117 - 122 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| chloromethyl pentachlorophenyl sulfide |
| EINECS 263-623-9 |
| Chlormethyl-pentachlorphenyl-sufid |