2,4,6-trinitro-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline structure
|
Common Name | 2,4,6-trinitro-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 62606-03-5 | Molecular Weight | 417.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6F3N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-trinitro-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline |
|---|
| Molecular Formula | C13H6F3N5O8 |
|---|---|
| Molecular Weight | 417.21100 |
| Exact Mass | 417.01700 |
| PSA | 195.31000 |
| LogP | 6.24760 |
| InChIKey | FAULMUAOLQAOJT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C(F)(F)F)c1 |
|
~%
2,4,6-trinitro-... CAS#:62606-03-5 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |