N-(3-chloro-5-methylsulfonylphenyl)-2,4,6-trinitroaniline structure
|
Common Name | N-(3-chloro-5-methylsulfonylphenyl)-2,4,6-trinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 62606-06-8 | Molecular Weight | 416.75100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-chloro-5-methylsulfonylphenyl)-2,4,6-trinitroaniline |
|---|
| Molecular Formula | C13H9ClN4O8S |
|---|---|
| Molecular Weight | 416.75100 |
| Exact Mass | 415.98300 |
| PSA | 192.01000 |
| LogP | 5.93510 |
| InChIKey | XJYNHRBIUJJIDL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(Cl)cc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
|
~%
N-(3-chloro-5-m... CAS#:62606-06-8 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |