N-[3-methoxy-5-(trifluoromethyl)phenyl]-2,4,6-trinitroaniline structure
|
Common Name | N-[3-methoxy-5-(trifluoromethyl)phenyl]-2,4,6-trinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 62606-09-1 | Molecular Weight | 402.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9F3N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-methoxy-5-(trifluoromethyl)phenyl]-2,4,6-trinitroaniline |
|---|
| Molecular Formula | C14H9F3N4O7 |
|---|---|
| Molecular Weight | 402.23900 |
| Exact Mass | 402.04200 |
| PSA | 158.72000 |
| LogP | 5.82480 |
| InChIKey | MTWMUMDQBVXMPV-UHFFFAOYSA-N |
| SMILES | COc1cc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C(F)(F)F)c1 |
|
~%
N-[3-methoxy-5-... CAS#:62606-09-1 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |