1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione
1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione structure
|
Common Name | 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione | ||
|---|---|---|---|---|
| CAS Number | 62619-62-9 | Molecular Weight | 354.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H22O5 |
|---|---|
| Molecular Weight | 354.39600 |
| Exact Mass | 354.14700 |
| PSA | 69.67000 |
| LogP | 3.89890 |
| InChIKey | JZXKDRKFFSSKBZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCC(=O)CCC(=O)c2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,7-bis(4-metho... CAS#:62619-62-9 |
| Literature: Stetter,H. et al. Chemische Berichte, 1977 , vol. 110, p. 1007 - 1019 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: Related upstream materials(CAS) of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione: 1890-28-4;123-11-5. |
| Q: What is the English name of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: The English name of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione. |
| Q: What is the polar surface area (PSA) of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: Polar surface area (PSA) of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is 69.67000. |
| Q: What is the InChIKey of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: InChIKey of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is JZXKDRKFFSSKBZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: Molecular formula of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is C21H22O5. |
| Q: What is the CAS number of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: CAS number of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is 62619-62-9. |
| Q: What is the Chinese name of 62619-62-9? |
| A: Chinese name of 62619-62-9 is 62619-62-9. |
| Q: What is the SMILES notation of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: SMILES notation of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is COc1ccc(C(=O)CCC(=O)CCC(=O)c2ccc(OC)cc2)cc1. |
| Q: What is the molecular weight of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: Molecular weight of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is 354.39600. |
| Q: What is the LogP of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione? |
| A: LogP of 1,7-bis(4-methoxyphenyl)heptane-1,4,7-trione is 3.89890. |