2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-methylsulfanyl-butanoic acid structure
|
Common Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-methylsulfanyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 62625-13-2 | Molecular Weight | 352.23400 | |
| Density | 1.401g/cm3 | Boiling Point | 609.9ºC at 760 mmHg | |
| Molecular Formula | C13H15Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.7ºC | |
| Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 609.9ºC at 760 mmHg |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.23400 |
| Flash Point | 322.7ºC |
| Exact Mass | 351.01000 |
| PSA | 100.93000 |
| LogP | 3.08560 |
| Index of Refraction | 1.58 |
| InChIKey | UJTANULYSZODGX-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O |
|
~%
2-[[2-(2,4-dich... CAS#:62625-13-2 |
| Literature: Wood; Fontaine Journal of Organic Chemistry, 1952 , vol. 17, p. 891,892, 894 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| DL-Methionine,4-dichlorophenoxy)acetyl] |
| n-[(2,4-dichlorophenoxy)acetyl]methionine |
| N-[(2,4-Dichlor-phenoxy)-acetyl]-DL-methionin |
| N-[(2,4-dichloro-phenoxy)-acetyl]-DL-methionine |