(5-oxo-1-phenylhexan-3-yl) acetate structure
|
Common Name | (5-oxo-1-phenylhexan-3-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 62627-08-1 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-oxo-1-phenylhexan-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.53000 |
| InChIKey | LQWLTOFTKCGGHD-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(CCc1ccccc1)OC(C)=O |
|
~%
(5-oxo-1-phenyl... CAS#:62627-08-1 |
| Literature: Sankyo Company Limited Patent: US4198425 A1, 1980 ; |
|
~%
(5-oxo-1-phenyl... CAS#:62627-08-1 |
| Literature: Sato; Ogiso; Noguchi; Mitsui; Kaneko; Shimada Chemical and pharmaceutical bulletin, 1980 , vol. 28, # 5 p. 1509 - 1525 |
|
~%
(5-oxo-1-phenyl... CAS#:62627-08-1 |
| Literature: Sato; Ogiso; Noguchi; Mitsui; Kaneko; Shimada Chemical and pharmaceutical bulletin, 1980 , vol. 28, # 5 p. 1509 - 1525 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-acetoxy-6-phenylhexan-2one |