acetic acid,[2-(7-hydroxyheptyl)cyclopenten-1-yl] acetate structure
|
Common Name | acetic acid,[2-(7-hydroxyheptyl)cyclopenten-1-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 62627-60-5 | Molecular Weight | 300.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,[2-(7-hydroxyheptyl)cyclopenten-1-yl] acetate |
|---|
| Molecular Formula | C16H28O5 |
|---|---|
| Molecular Weight | 300.39100 |
| Exact Mass | 300.19400 |
| PSA | 83.83000 |
| LogP | 3.41130 |
| InChIKey | CUKUPROYJMHXMP-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)OC1=C(CCCCCCCO)CCC1 |
|
~%
acetic acid,[2-... CAS#:62627-60-5 |
| Literature: Burton; Caton; Coffee; Parker; Stuttle; Watkins Journal of the Chemical Society. Perkin transactions 1, 1976 , # 23 p. 2550 - 2556 |
|
~%
acetic acid,[2-... CAS#:62627-60-5 |
| Literature: Burton; Caton; Coffee; Parker; Stuttle; Watkins Journal of the Chemical Society. Perkin transactions 1, 1976 , # 23 p. 2550 - 2556 |