Methane,bis(2,2,2-tribromoethoxy)- (7CI,8CI) structure
|
Common Name | Methane,bis(2,2,2-tribromoethoxy)- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 6263-68-9 | Molecular Weight | 577.52400 | |
| Density | 2.845g/cm3 | Boiling Point | 459.2ºC at 760 mmHg | |
| Molecular Formula | C5H6Br6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 1,1,1-tribromo-2-(2,2,2-tribromoethoxymethoxy)ethane |
|---|
| Density | 2.845g/cm3 |
|---|---|
| Boiling Point | 459.2ºC at 760 mmHg |
| Molecular Formula | C5H6Br6O2 |
| Molecular Weight | 577.52400 |
| Flash Point | 191.2ºC |
| Exact Mass | 571.54700 |
| PSA | 18.46000 |
| LogP | 4.65410 |
| Index of Refraction | 1.661 |
| InChIKey | RXUANTDRTVVNMP-UHFFFAOYSA-N |
| SMILES | BrC(Br)(Br)COCOCC(Br)(Br)Br |
|
~%
Methane,bis(2,2... CAS#:6263-68-9 |
| Literature: Shipp,K.G.; Hill,M.E. Journal of Organic Chemistry, 1966 , vol. 31, p. 853 - 856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |