di(1,1,3-trihydroperfluoropropoxy)methane
di(1,1,3-trihydroperfluoropropoxy)methane structure
|
Common Name | di(1,1,3-trihydroperfluoropropoxy)methane | ||
|---|---|---|---|---|
| CAS Number | 6263-72-5 | Molecular Weight | 276.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Di(1,1,3-trihydroperfluoropropoxy)methane, Chinese name 二(1,1,3-三氟代次丙氧基)甲烷, CAS number 6263-72-5, molecular formula C7H8F8O2, molecular weight 276.12400, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | di(1,1,3-trihydroperfluoropropoxy)methane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H8F8O2 |
|---|---|
| Molecular Weight | 276.12400 |
| Exact Mass | 276.04000 |
| PSA | 18.46000 |
| LogP | 2.77790 |
| InChIKey | GOJDQBUTQNNFII-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)COCOCC(F)(F)C(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Bis(2,2,3,3-tetrafluoropropyl)formal |
| Bis-(2,2,3,3-tetrafluor-propyl)-formal |
| bis-(2,2,3,3-tetrafluoro-propoxy)-methane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: CAS number of di(1,1,3-trihydroperfluoropropoxy)methane is 6263-72-5. |
| Q: What English synonyms does di(1,1,3-trihydroperfluoropropoxy)methane have? |
| A: English synonyms of di(1,1,3-trihydroperfluoropropoxy)methane: Bis(2,2,3,3-tetrafluoropropyl)formal, Bis-(2,2,3,3-tetrafluor-propyl)-formal, bis-(2,2,3,3-tetrafluoro-propoxy)-methane. |
| Q: What is the Chinese name of 6263-72-5? |
| A: Chinese name of 6263-72-5 is 6263-72-5. |
| Q: What is the LogP of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: LogP of di(1,1,3-trihydroperfluoropropoxy)methane is 2.77790. |
| Q: What is the molecular formula of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: Molecular formula of di(1,1,3-trihydroperfluoropropoxy)methane is C7H8F8O2. |
| Q: What is the English name of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: The English name of di(1,1,3-trihydroperfluoropropoxy)methane is di(1,1,3-trihydroperfluoropropoxy)methane. |
| Q: What is the SMILES notation of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: SMILES notation of di(1,1,3-trihydroperfluoropropoxy)methane is FC(F)C(F)(F)COCOCC(F)(F)C(F)F. |
| Q: What is the InChIKey of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: InChIKey of di(1,1,3-trihydroperfluoropropoxy)methane is GOJDQBUTQNNFII-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: Polar surface area (PSA) of di(1,1,3-trihydroperfluoropropoxy)methane is 18.46000. |
| Q: What is the molecular weight of di(1,1,3-trihydroperfluoropropoxy)methane? |
| A: Molecular weight of di(1,1,3-trihydroperfluoropropoxy)methane is 276.12400. |