2-Amino-6-nitro-p-cresol structure
|
Common Name | 2-Amino-6-nitro-p-cresol | ||
|---|---|---|---|---|
| CAS Number | 6265-07-2 | Molecular Weight | 168.15000 | |
| Density | 1.421 g/cm3 | Boiling Point | 299.1ºC at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | 2-amino-4-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421 g/cm3 |
|---|---|
| Boiling Point | 299.1ºC at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Flash Point | 134.7ºC |
| Exact Mass | 168.05300 |
| PSA | 92.07000 |
| LogP | 2.29540 |
| Index of Refraction | 1.661 |
| InChIKey | AJWIWEGQLDDWQC-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c(O)c([N+](=O)[O-])c1 |
| HS Code | 2922299090 |
|---|
|
~95%
2-Amino-6-nitro... CAS#:6265-07-2 |
| Literature: Avyyangar; Kalkote; Lugade; Nikrad; Sharma Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 10 p. 3159 - 3164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-3-amino-4-oxy-1-methyl-benzol |
| 2-Amino-4-methyl-6-nitro-phenol |
| MFCD00035769 |
| 6-Nitro-4-methyl-2-aminophenol |
| 2-nitro-4-methyl-6-amino-phenol |
| 2-amino-6-nitro-4-methylphenol |
| 2-Nitro-3-amino-4-oxy-toluol |
| 2-Amino-6-nitro-p-cresol |
| 2-azanyl-4-methyl-6-nitro-phenol |
| EINECS 228-430-6 |
| 3-amino-4-hydroxy-5-nitrotoluene |