2-(1-methylindol-3-yl)-4-oxo-4-phenyl-butanoic acid structure
|
Common Name | 2-(1-methylindol-3-yl)-4-oxo-4-phenyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6266-67-7 | Molecular Weight | 307.34300 | |
| Density | 1.2g/cm3 | Boiling Point | 553.9ºC at 760 mmHg | |
| Molecular Formula | C19H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.8ºC | |
| Name | 2-(1-methyl-1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 553.9ºC at 760 mmHg |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.34300 |
| Flash Point | 288.8ºC |
| Exact Mass | 307.12100 |
| PSA | 59.30000 |
| LogP | 3.61950 |
| Index of Refraction | 1.614 |
| InChIKey | CFCVZKGESVQTIL-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(CC(=O)c2ccccc2)C(=O)O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |