4-methyl-N-naphthalen-1-yl-piperazine-1-carboxamide
Modify Date: 2025-09-24 10:16:40
4-methyl-N-naphthalen-1-yl-piperazine-1-carboxamide structure
|
Common Name | 4-methyl-N-naphthalen-1-yl-piperazine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6266-76-8 | Molecular Weight | 269.34200 | |
| Density | 1.217g/cm3 | Boiling Point | 494.7ºC at 760 mmHg | |
| Molecular Formula | C16H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253ºC | |
| Name | 4-methyl-N-naphthalen-1-ylpiperazine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 494.7ºC at 760 mmHg |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.34200 |
| Flash Point | 253ºC |
| Exact Mass | 269.15300 |
| PSA | 35.58000 |
| LogP | 2.56790 |
| Index of Refraction | 1.662 |
| InChIKey | DVQPJJRULICNLY-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)Nc2cccc3ccccc23)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
4-methyl-N-naph... CAS#:6266-76-8 |
| Literature: Morren et al. Bulletin des Societes Chimiques Belges, 1950 , vol. 59, p. 228,234 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-piperazine-1-carboxylic acid-[1]naphthylamide |
| 4-Methyl-piperazin-1-carbonsaeure-[1]naphthylamid |
| 4-methyl-n-(1-naphthyl)piperazine-1-carboxamide |
| 4-methyl-N-(naphthalen-1-yl)piperazine-1-carboxamide |