4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione
![4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione Structure](https://image.chemsrc.com/caspic/229/62668-76-2.png)
4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione structure
|
Common Name | 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 62668-76-2 | Molecular Weight | 305.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione, CAS number 62668-76-2, molecular formula C18H11NO4, molecular weight 305.28400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H11NO4 |
|---|---|
| Molecular Weight | 305.28400 |
| Exact Mass | 305.06900 |
| PSA | 83.56000 |
| LogP | 3.41940 |
| InChIKey | MCKWWFMHICPESU-UHFFFAOYSA-N |
| SMILES | O=c1oc2[nH]c3ccccc3c(=O)c2c(O)c1-c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-hydroxy-3-phe... CAS#:62668-76-2 |
| Literature: Noehammer,G.; Kappe,T. Monatshefte fuer Chemie, 1976 , vol. 107, p. 859 - 863 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Hydroxy-3-phenyl-2H-pyrano<2,3-b>chinolin-2,5(10H)-dion |
| 2H-Pyrano[2,3-b]quinoline-2,5(10H)-dione,4-hydroxy-3-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: Polar surface area (PSA) of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is 83.56000. |
| Q: What is the LogP of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: LogP of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is 3.41940. |
| Q: What is the CAS number of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: CAS number of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is 62668-76-2. |
| Q: What is the SMILES notation of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: SMILES notation of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is O=c1oc2[nH]c3ccccc3c(=O)c2c(O)c1-c1ccccc1. |
| Q: What is the English name of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: The English name of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione. |
| Q: What is the Chinese name of 62668-76-2? |
| A: Chinese name of 62668-76-2 is 62668-76-2. |
| Q: What is the InChIKey of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: InChIKey of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is MCKWWFMHICPESU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: Molecular weight of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is 305.28400. |
| Q: What English synonyms does 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione have? |
| A: English synonyms of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione: 4-Hydroxy-3-phenyl-2H-pyranochinolin-2,5(10H)-dion, 2H-Pyrano[2,3-b]quinoline-2,5(10H)-dione,4-hydroxy-3-phenyl. |
| Q: What is the molecular formula of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione? |
| A: Molecular formula of 4-hydroxy-3-phenyl-10H-pyrano[2,3-b]quinoline-2,5-dione is C18H11NO4. |