Coumarin 339 structure
|
Common Name | Coumarin 339 | ||
|---|---|---|---|---|
| CAS Number | 62669-73-2 | Molecular Weight | 215.24800 | |
| Density | 1.209g/cm3 | Boiling Point | 407.1ºC at 760mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-6,7,8,9-tetrahydropyrano[3,2-g]quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Exact Mass | 215.09500 |
| PSA | 42.24000 |
| LogP | 2.59750 |
| Index of Refraction | 1.589 |
| InChIKey | PZTQNUMZYIQRGY-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc3c(cc12)CCCN3 |
| HS Code | 2934999090 |
|---|
|
~%
Coumarin 339 CAS#:62669-73-2 |
| Literature: Journal of Organic Chemistry, , vol. 43, p. 1975 - 1980 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Coumarin 339 |
| HMS2879P13 |