methyl 3-bromo-4-oxo-2,4-diphenyl-butanoate structure
|
Common Name | methyl 3-bromo-4-oxo-2,4-diphenyl-butanoate | ||
|---|---|---|---|---|
| CAS Number | 6267-06-7 | Molecular Weight | 347.20300 | |
| Density | 1.394g/cm3 | Boiling Point | 438.6ºC at 760 mmHg | |
| Molecular Formula | C17H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | methyl 3-bromo-4-oxo-2,4-diphenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 438.6ºC at 760 mmHg |
| Molecular Formula | C17H15BrO3 |
| Molecular Weight | 347.20300 |
| Flash Point | 219.1ºC |
| Exact Mass | 346.02000 |
| PSA | 43.37000 |
| LogP | 3.58960 |
| Index of Refraction | 1.59 |
| InChIKey | NHCIONQNUCGXOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)C(Br)C(=O)c1ccccc1 |
|
~%
methyl 3-bromo-... CAS#:6267-06-7 |
| Literature: Kohler, Peterson, Bickel Journal of the American Chemical Society, 1934 , vol. 56, p. 2000,2005 |
|
~%
methyl 3-bromo-... CAS#:6267-06-7 |
| Literature: Kohler, Peterson, Bickel Journal of the American Chemical Society, 1934 , vol. 56, p. 2000,2005 |
|
~%
methyl 3-bromo-... CAS#:6267-06-7 |
| Literature: Kohler, Goodwin Journal of the American Chemical Society, 1927 , vol. 49, p. 222 |
|
~%
methyl 3-bromo-... CAS#:6267-06-7 |
| Literature: Kohler, Kimball Journal of the American Chemical Society, 1934 , vol. 56, p. 729 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-Brom-4-oxo-2,4-diphenyl-buttersaeure-methylester |
| 3-bromo-4-oxo-2,4-diphenyl-butyric acid methyl ester |
| 3-Brom-2-phenyl-3-benzoyl-propionsaeure-methylester |