6-nitro-3-phenyl-1H-4,1,2-benzothiadiazine structure
|
Common Name | 6-nitro-3-phenyl-1H-4,1,2-benzothiadiazine | ||
|---|---|---|---|---|
| CAS Number | 62672-41-7 | Molecular Weight | 271.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-nitro-3-phenyl-1H-4,1,2-benzothiadiazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9N3O2S |
|---|---|
| Molecular Weight | 271.29400 |
| Exact Mass | 271.04200 |
| PSA | 95.51000 |
| LogP | 3.57100 |
| InChIKey | PKLFWTBSDFCNCO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SC(c1ccccc1)=NN2 |
|
~%
6-nitro-3-pheny... CAS#:62672-41-7 |
| Literature: Vukov,D.J. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 192 - 196 |
| 6-nitro-3-phenyl-1H-benzo[1,3,4]thiadiazine |
| 6-Nitro-3-phenyl-1H-4,1,2-benzothiadiazin |
| 1H-4,1,2-Benzothiadiazine,6-nitro-3-phenyl |