2-[(4-carboxyphenyl)methyl]benzoic acid structure
|
Common Name | 2-[(4-carboxyphenyl)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6268-08-2 | Molecular Weight | 256.25300 | |
| Density | 1.321g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | 2-[(4-carboxyphenyl)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 255.4ºC |
| Exact Mass | 256.07400 |
| PSA | 74.60000 |
| LogP | 2.67380 |
| Index of Refraction | 1.635 |
| InChIKey | SXJJRDVGHKSPCS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cc2ccccc2C(=O)O)cc1 |
|
~%
2-[(4-carboxyph... CAS#:6268-08-2 |
| Literature: Copp; Simonsen Journal of the Chemical Society, 1942 , p. 209,211 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(4-carboxybenzyl)benzoic acid |
| 2,4'-methanediyl-di-benzoic acid |
| Diphenylmethan-dicarbonsaeure-(2.4') |
| 2,4'-Methandiyl-di-benzoesaeure |