ethyl N-[4-(ethoxycarbonyl-nitro-amino)butyl]-N-nitro-carbamate structure
|
Common Name | ethyl N-[4-(ethoxycarbonyl-nitro-amino)butyl]-N-nitro-carbamate | ||
|---|---|---|---|---|
| CAS Number | 6268-41-3 | Molecular Weight | 322.27200 | |
| Density | 1.339g/cm3 | Boiling Point | 448.8ºC at 760 mmHg | |
| Molecular Formula | C10H18N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | ethyl N-[4-[ethoxycarbonyl(nitro)amino]butyl]-N-nitrocarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760 mmHg |
| Molecular Formula | C10H18N4O8 |
| Molecular Weight | 322.27200 |
| Flash Point | 225.2ºC |
| Exact Mass | 322.11200 |
| PSA | 150.72000 |
| LogP | 2.11340 |
| Index of Refraction | 1.505 |
| InChIKey | MVSZYXXQOBGUEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(CCCCN(C(=O)OCC)[N+](=O)[O-])[N+](=O)[O-] |
|
~%
ethyl N-[4-(eth... CAS#:6268-41-3 |
| Literature: Curry; Mason Journal of the American Chemical Society, 1951 , vol. 73, p. 5043,5044 Journal of the American Chemical Society, 1953 , vol. 75, p. 6357 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-Dinitro-N,N'-butandiyl-bis-carbamidsaeure-diaethylester |
| N,N'-dinitro-N,N'-butanediyl-bis-carbamic acid diethyl ester |