ethyl N-[6-(ethoxycarbonyl-nitro-amino)hexyl]-N-nitro-carbamate structure
|
Common Name | ethyl N-[6-(ethoxycarbonyl-nitro-amino)hexyl]-N-nitro-carbamate | ||
|---|---|---|---|---|
| CAS Number | 6268-46-8 | Molecular Weight | 350.32500 | |
| Density | 1.28g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C12H22N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | ethyl N-[6-[ethoxycarbonyl(nitro)amino]hexyl]-N-nitrocarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C12H22N4O8 |
| Molecular Weight | 350.32500 |
| Flash Point | 238.5ºC |
| Exact Mass | 350.14400 |
| PSA | 150.72000 |
| LogP | 2.89360 |
| Index of Refraction | 1.501 |
| InChIKey | PSBAURNYAWRWIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(CCCCCCN(C(=O)OCC)[N+](=O)[O-])[N+](=O)[O-] |
|
~%
ethyl N-[6-(eth... CAS#:6268-46-8 |
| Literature: Curry; Mason Journal of the American Chemical Society, 1951 , vol. 73, p. 5043,5044 Journal of the American Chemical Society, 1953 , vol. 75, p. 6357 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| diethyl hexane-1,6-diylbis(nitrocarbamate) |
| N,N'-Dinitro-N,N'-hexandiyl-bis-carbamidsaeure-diaethylester |
| 1,6-Bis-(aethoxycarbonyl-nitro-amino)-hexan |
| N,N'-dinitro-N,N'-hexanediyl-bis-carbamic acid diethyl ester |