Pyridinium,1-[2-[4-(acetyloxy)-3-methoxyphenyl]-1-methyl-2-oxoethyl]-, bromide (1:1) structure
|
Common Name | Pyridinium,1-[2-[4-(acetyloxy)-3-methoxyphenyl]-1-methyl-2-oxoethyl]-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6269-02-9 | Molecular Weight | 380.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-methoxy-4-(2-pyridin-1-ium-1-ylpropanoyl)phenyl] acetate,bromide |
|---|
| Molecular Formula | C17H18BrNO4 |
|---|---|
| Molecular Weight | 380.23300 |
| Exact Mass | 379.04200 |
| PSA | 56.48000 |
| InChIKey | CFEOWZVFTUDMSA-UHFFFAOYSA-M |
| SMILES | COc1cc(C(=O)C(C)[n+]2ccccc2)ccc1OC(C)=O.[Br-] |
|
~%
Pyridinium,1-[2... CAS#:6269-02-9 |
| Literature: Riegel; Wittcoff Journal of the American Chemical Society, 1946 , vol. 68, p. 1913,1916 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |