4-(4-chlorophenyl)-4-methyl-pentan-2-one structure
|
Common Name | 4-(4-chlorophenyl)-4-methyl-pentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 6269-30-3 | Molecular Weight | 210.70000 | |
| Density | 1.063g/cm3 | Boiling Point | 279.2ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | 4-(4-chlorophenyl)-4-methylpentan-2-one |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 279.2ºC at 760 mmHg |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70000 |
| Flash Point | 162.2ºC |
| Exact Mass | 210.08100 |
| PSA | 17.07000 |
| LogP | 3.59670 |
| Index of Refraction | 1.505 |
| InChIKey | AXLXJEZHGWFCPX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)c1ccc(Cl)cc1 |
|
~19%
4-(4-chlorophen... CAS#:6269-30-3 |
| Literature: Baumann, Karlheinz; Flohr, Alexander; Goetschi, Erwin; Jacobsen, Helmut; Jolidon, Synese; Luebbers, Thomas Patent: US2009/215759 A1, 2009 ; Location in patent: Page/Page column 24-25 ; |
|
~83%
4-(4-chlorophen... CAS#:6269-30-3 |
| Literature: Klement, Ingo; Stadtmueller, Heinz; Knochel, Paul; Cahiez, Gerard Tetrahedron Letters, 1997 , vol. 38, # 11 p. 1927 - 1930 |
|
~%
4-(4-chlorophen... CAS#:6269-30-3 |
| Literature: Corse; Rohrmann Journal of the American Chemical Society, 1948 , vol. 70, p. 370 |