2-(benzo[1,3]dioxol-5-ylmethyl)benzothiazole structure
|
Common Name | 2-(benzo[1,3]dioxol-5-ylmethyl)benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 6269-48-3 | Molecular Weight | 269.31800 | |
| Density | 1.368g/cm3 | Boiling Point | 434.5ºC at 760 mmHg | |
| Molecular Formula | C15H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | 2-(1,3-benzodioxol-5-ylmethyl)-1,3-benzothiazole |
|---|
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 434.5ºC at 760 mmHg |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.31800 |
| Flash Point | 216.6ºC |
| Exact Mass | 269.05100 |
| PSA | 59.59000 |
| LogP | 3.61580 |
| Index of Refraction | 1.699 |
| InChIKey | BXRZTMWCXSTXDM-UHFFFAOYSA-N |
| SMILES | c1ccc2sc(Cc3ccc4c(c3)OCO4)nc2c1 |
|
~66%
2-(benzo[1,3]di... CAS#:6269-48-3 |
| Literature: Subhashini, N J Prameela; Hanumanthu, P Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 4 p. 427 - 429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |