5-(1,3-benzodioxol-5-yl)-1-phenylimidazolidin-2-one structure
|
Common Name | 5-(1,3-benzodioxol-5-yl)-1-phenylimidazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 62705-57-1 | Molecular Weight | 282.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(1,3-benzodioxol-5-yl)-1-phenylimidazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2O3 |
|---|---|
| Molecular Weight | 282.29400 |
| Exact Mass | 282.10000 |
| PSA | 54.29000 |
| LogP | 2.39120 |
| InChIKey | LTNUDBOPTIFRLB-UHFFFAOYSA-N |
| SMILES | O=C1NCC(c2ccc3c(c2)OCO3)N1c1ccccc1 |
|
~%
5-(1,3-benzodio... CAS#:62705-57-1 |
| Literature: Archer,D.A.; Singer,B.W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2484 - 2488 |
|
~%
5-(1,3-benzodio... CAS#:62705-57-1 |
| Literature: Archer,D.A.; Singer,B.W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2484 - 2488 |
| 2-Imidazolidinone,5-(1,3-benzodioxol-5-yl)-1-phenyl |
| 5-benzo[1,3]dioxol-5-yl-1-phenyl-imidazolidin-2-one |