benzoic acid,4-[(3-chlorophenyl)methyl]phenol structure
|
Common Name | benzoic acid,4-[(3-chlorophenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 62707-02-2 | Molecular Weight | 340.80000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzoic acid,4-[(3-chlorophenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H17ClO3 |
|---|---|
| Molecular Weight | 340.80000 |
| Exact Mass | 340.08700 |
| PSA | 57.53000 |
| LogP | 5.02120 |
| InChIKey | HKBOMSQLYKZYHN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1.Oc1ccc(Cc2cccc(Cl)c2)cc1 |
|
~%
benzoic acid,4-... CAS#:62707-02-2 |
| Literature: Huston et al. Journal of the American Chemical Society, 1933 , vol. 55, p. 4639,4640 |
| 1-benzoyloxy-4-(3-chloro-benzyl)-benzene |
| Phenol,4-[(3-chlorophenyl)methyl]-,benzoate |
| 1-Benzoyloxy-4-(3-chlor-benzyl)-benzol |