(Cys47)-HIV-1 tat Protein (47-57) structure
|
Common Name | (Cys47)-HIV-1 tat Protein (47-57) | ||
|---|---|---|---|---|
| CAS Number | 627079-23-6 | Molecular Weight | 1499.797 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1510.7±75.0 °C at 760 mmHg | |
| Molecular Formula | C58H114N32O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 867.4±37.1 °C | |
Use of (Cys47)-HIV-1 tat Protein (47-57)(Cys47)-HIV-1 tat Protein (47-57) has membrane translocation function and can be used to derivatize the surface of magnetic pharmaceuticals and substantially facilitated their uptake into target cells[1][2]. |
| Name | (Cys47)-HIV-1 tat Protein (47-57) trifluoroacetate salt |
|---|---|
| Synonym | More Synonyms |
| Description | (Cys47)-HIV-1 tat Protein (47-57) has membrane translocation function and can be used to derivatize the surface of magnetic pharmaceuticals and substantially facilitated their uptake into target cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1510.7±75.0 °C at 760 mmHg |
| Molecular Formula | C58H114N32O13S |
| Molecular Weight | 1499.797 |
| Flash Point | 867.4±37.1 °C |
| Exact Mass | 1498.896362 |
| LogP | -3.28 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | VBAZQDRBBPEGAC-QMAXXTOWSA-N |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| N2-[(2S,5S,8S,11S,14S,17S,20S,23S,29R)-29-Amino-17,20-bis(4-aminobutyl)-2,5,11,14,23-pentakis(3-carbamimidamidopropyl)-1,4,7,10,13,16,19,22,25,28-decahydroxy-8-(3-hydroxy-3-iminopropyl)-30-sulfanyl- 3,6,9,12,15,18,21,24,27-nonaazatriaconta-3,6,9,12,15,18,21,24,27-nonaen-1-ylidene]-L-arginine |
| L-Arginine, N2-[(2S,5S,8S,11S,14S,17S,20S,23S,29R)-29-amino-17,20-bis(4-aminobutyl)-2,5,11,14,23-pentakis[3-[(aminoiminomethyl)amino]propyl]-1,4,7,10,13,16,19,22,25,28-decahydroxy-8-(3-hydroxy-3-imi 
nopropyl)-30-mercapto-3,6,9,12,15,18,21,24,27-nonaazatriaconta-3,6,9,12,15,18,21,24,27-nonaen-1-ylidene]- |
| MFCD10567238 |