Ethanaminium,2-[(3,3-dimethyl-2-phenyl-2-oxiranyl)oxy]-N,N,N-trimethyl-, iodide (1:1) structure
|
Common Name | Ethanaminium,2-[(3,3-dimethyl-2-phenyl-2-oxiranyl)oxy]-N,N,N-trimethyl-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6271-20-1 | Molecular Weight | 250.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24NO2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,3-dimethyl-2-phenyloxiran-2-yl)oxyethyl-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24NO2+ |
|---|---|
| Molecular Weight | 250.35700 |
| Exact Mass | 250.18100 |
| PSA | 21.76000 |
| LogP | 2.37100 |
| InChIKey | QMSNQNAFUMXSBA-UHFFFAOYSA-N |
| SMILES | CC1(C)OC1(OCC[N+](C)(C)C)c1ccccc1 |
|
~%
Ethanaminium,2-... CAS#:6271-20-1 |
| Literature: Stevens; Ettling Journal of the American Chemical Society, 1955 , vol. 77, p. 5412 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Spofa 325 |
| Theadrylettae |
| Mephenhydramine |
| Mephenhydraminum |
| Moxastine |
| Therdryl |
| Moxastin |