ethyl (E)-3-(2-chlorophenyl)-3-(4-chlorophenyl)-2-cyano-prop-2-enoate structure
|
Common Name | ethyl (E)-3-(2-chlorophenyl)-3-(4-chlorophenyl)-2-cyano-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 62715-63-3 | Molecular Weight | 346.20700 | |
| Density | 1.296g/cm3 | Boiling Point | 466.1ºC at 760 mmHg | |
| Molecular Formula | C18H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | ethyl 3-(2-chlorophenyl)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 466.1ºC at 760 mmHg |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.20700 |
| Flash Point | 235.7ºC |
| Exact Mass | 345.03200 |
| PSA | 50.09000 |
| LogP | 4.88198 |
| Index of Refraction | 1.592 |
| InChIKey | NDHOGCCGRSTNBQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=C(c1ccc(Cl)cc1)c1ccccc1Cl |
|
~%
ethyl (E)-3-(2-... CAS#:62715-63-3 |
| Literature: Cragoe et al. Journal of Organic Chemistry, 1950 , vol. 15, p. 381,386, 389 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-chloro-phenyl)-3-(4-chloro-phenyl)-2-cyano-acrylic acid ethyl ester |
| ETHYL (E)-3-(2-CHLOROPHENYL)-3-(4-CHLOROPHENYL)-2-CYANO-PROP-2-ENOATE |
| 3-(2-Chlor-phenyl)-3-(4-chlor-phenyl)-2-cyan-acrylsaeure-aethylester |