2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-3-prop-2-enyl-benzothiazol-2-ylidene)acetamide structure
|
Common Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-3-prop-2-enyl-benzothiazol-2-ylidene)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6273-70-7 | Molecular Weight | 348.66500 | |
| Density | 1.36g/cm3 | Boiling Point | 580.1ºC at 760 mmHg | |
| Molecular Formula | C17H15BrClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.7ºC | |
| Name | 2-Chlor-5-nitronaphthalin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 580.1ºC at 760 mmHg |
| Molecular Formula | C17H15BrClN |
| Molecular Weight | 348.66500 |
| Flash Point | 304.7ºC |
| Exact Mass | 347.00800 |
| PSA | 3.88000 |
| LogP | 1.02740 |
| Index of Refraction | 1.692 |
| InChIKey | NDOAFXJAROTMBA-UHFFFAOYSA-M |
| SMILES | Clc1ccc2c(ccc[n+]2CCc2ccccc2)c1.[Br-] |
|
~%
2-(1,3-dioxoiso... CAS#:6273-70-7 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-chloro-1-phenethyl-quinolinium,bromide |
| 1-Nitro-6-chloronaphthalene |
| 6-Chlor-1-phenaethyl-chinolinium,Bromid |
| 6-chloro-1-nitro-naphthalene |
| 6-Chlor-1-nitro-naphthalin |
| 1-Nitro-6-chlornaphthalin |
| Naphthalene,6-chloro-1-nitro |