Benzoic acid,4-(methylsulfonyl)-, ethyl ester structure
|
Common Name | Benzoic acid,4-(methylsulfonyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6274-54-0 | Molecular Weight | 228.26500 | |
| Density | 1.229g/cm3 | Boiling Point | 387.2ºC at 760 mmHg | |
| Molecular Formula | C10H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | ethyl 4-methylsulfonylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 387.2ºC at 760 mmHg |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.26500 |
| Flash Point | 188ºC |
| Exact Mass | 228.04600 |
| PSA | 68.82000 |
| LogP | 2.34760 |
| Index of Refraction | 1.514 |
| InChIKey | ADTIKXSMRDSYSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(S(C)(=O)=O)cc1 |
| HS Code | 2916399090 |
|---|
|
~84%
Benzoic acid,4-... CAS#:6274-54-0 |
| Literature: Brembilla, Alain; Roizard, Denis; Schoenleber, Jacqueline; Lochon, Pierre Canadian Journal of Chemistry, 1984 , vol. 62, p. 2330 - 2336 |
|
~%
Benzoic acid,4-... CAS#:6274-54-0 |
| Literature: Brembilla, Alain; Roizard, Denis; Schoenleber, Jacqueline; Lochon, Pierre Canadian Journal of Chemistry, 1984 , vol. 62, p. 2330 - 2336 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methylsulfonyl-4 benzoate d'ethyle |
| 4-Methansulfonyl-benzoesaeure-ethylester |
| 4-Methansulfonyl-benzoesaeure-aethylester |
| 4-METHANESULFONYL-BENZOIC ACID ETHYL ESTER |
| ethyl 4-(methylsulfonyl)benzoate |
| ethyl 4-methanesulfonylbenzoate |
| Ethyl-4-(methansulfonyl)benzoat |