1-[[chloro-(4-nitrophenyl)methyl]sulfanylmethyl]-4-nitrobenzene structure
|
Common Name | 1-[[chloro-(4-nitrophenyl)methyl]sulfanylmethyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 62740-56-1 | Molecular Weight | 338.76600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[chloro-(4-nitrophenyl)methyl]sulfanylmethyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClN2O4S |
|---|---|
| Molecular Weight | 338.76600 |
| Exact Mass | 338.01300 |
| PSA | 116.94000 |
| LogP | 5.72020 |
| InChIKey | LMQUWXJUPSSEPL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CSC(Cl)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-[[chloro-(4-n... CAS#:62740-56-1 |
| Literature: Kirby, Gordon W.; Lochead, Alistair W.; Sheldrake, Gary N. Journal of the Chemical Society, Chemical Communications, 1984 , # 22 p. 1469 - 1470 |
| Benzene,1-[chloro[[(4-nitrophenyl)methyl]thio]methyl]-4-nitro |