2-[(2,6-dimethyl-2H-pyran-4-yl)sulfanyl]-1-(4-phenylphenyl)ethanone structure
|
Common Name | 2-[(2,6-dimethyl-2H-pyran-4-yl)sulfanyl]-1-(4-phenylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6275-20-3 | Molecular Weight | 415.34300 | |
| Density | 1.19g/cm3 | Boiling Point | 496.9ºC at 760 mmHg | |
| Molecular Formula | C21H19BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | 2-(2,6-dimethylpyrylium-4-yl)sulfanyl-1-(4-phenylphenyl)ethanone,bromide |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 496.9ºC at 760 mmHg |
| Molecular Formula | C21H19BrO2S |
| Molecular Weight | 415.34300 |
| Flash Point | 245.3ºC |
| Exact Mass | 414.02900 |
| PSA | 55.51000 |
| LogP | 2.82350 |
| Index of Refraction | 1.629 |
| InChIKey | BUXGDIQQNGXWLW-UHFFFAOYSA-M |
| SMILES | Cc1cc(SCC(=O)c2ccc(-c3ccccc3)cc2)cc(C)[o+]1.[Br-] |
|
~%
2-[(2,6-dimethy... CAS#:6275-20-3 |
| Literature: Ozog et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 6225 |
|
~%
2-[(2,6-dimethy... CAS#:6275-20-3 |
| Literature: Ozog et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 6225 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |