1,3,5-Triazine-2,4-diamine,6-chloro-N,N'-bis(2-methoxyphenyl) structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-chloro-N,N'-bis(2-methoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 62752-06-1 | Molecular Weight | 357.79400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2-N,4-N-bis(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16ClN5O2 |
|---|---|
| Molecular Weight | 357.79400 |
| Exact Mass | 357.09900 |
| PSA | 87.65000 |
| LogP | 2.87320 |
| InChIKey | BVTLUNCYZNMSJD-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1nc(Cl)nc(Nc2ccccc2OC)n1 |
|
~80%
1,3,5-Triazine-... CAS#:62752-06-1 |
| Literature: Desai; Dodiya; Trivedi; Shah Medicinal Chemistry Research, 2008 , vol. 17, # 8 p. 495 - 506 |
|
~%
1,3,5-Triazine-... CAS#:62752-06-1 |
| Literature: Desai; Ravat; Shah Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 2 p. 367 - 373 |
| HMS2672K19 |
| 1,3,5-Triazine-2,4-diamine,6-chloro-N,N'-bis(2-methoxyphenyl) |
| {4-chloro-6-[(2-methoxyphenyl)amino](1,3,5-triazin-2-yl)}(2-methoxyphenyl)amin e |
| 6-chloro-N,N'-bis(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |