Gerfelin structure
|
Common Name | Gerfelin | ||
|---|---|---|---|---|
| CAS Number | 627545-07-7 | Molecular Weight | 290.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GerfelinGerfelin is an osteoclastogenesis inhibitor (IC50=61 uM) through the competitive inhibition of glyoxalase I (GLO1) with Ki of 0.15 uM. |
| Name | gerfelin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O6 |
|---|---|
| Molecular Weight | 290.26800 |
| Exact Mass | 290.07900 |
| PSA | 107.22000 |
| LogP | 2.91070 |
| InChIKey | BGSIXQHNQUBHAX-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(O)c(Oc2cc(C)c(C(=O)O)c(O)c2)c1 |
| Gerfelin |
| 4-(2,3-dihydroxy-5-methylphenoxy)-2-hydroxy-6-methylbenzoic acid |